About N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride
N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 56593711) has the molecular formula C18H22Cl2N4S
and a molecular weight of 397.38 g/mol. Its IUPAC name is N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride |
| PubChem CID | 56593711 |
| Molecular Formula | C18H22Cl2N4S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | CN1CCC(c2c[nH]c3cc(/N=C(\N)c4cccs4)ccc23)C1.Cl.Cl |
| InChI | InChI=1S/C18H20N4S.2ClH/c1-22-7-6-12(11-22)15-10-20-16-9-13(4-5-14(15)16)21-18(19)17-3-2-8-23-17;;/h2-5,8-10,12,20H,6-7,11H2,1H3,(H2,19,21);2*1H |
| InChIKey | RTNBJOIWSBQDLZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride?
The IUPAC name of N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride (CID 56593711) is N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride.
What is the SMILES notation for N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride?
The canonical SMILES for N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride is CN1CCC(c2c[nH]c3cc(/N=C(\N)c4cccs4)ccc23)C1.Cl.Cl.
What is the InChIKey of N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride?
The InChIKey is RTNBJOIWSBQDLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4S.2ClH/c1-22-7-6-12(11-22)15-10-20-16-9-13(4-5-14(15)16)21-18(19)17-3-2-8-23-17;;/h2-5,8-10,12,20H,6-7,11H2,1H3,(H2,19,21);2*1H.
What are the key properties of N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride?
N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride has a molecular weight of 397.38 g/mol, XLogP of 4.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(1-methylpyrrolidin-3-yl)-1H-indol-6-yl]thiophene-2-carboximidamide;dihydrochloride is sourced from PubChem (CID 56593711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).