C15H22N4O4S2 — CID 56593800
N',4-diethyl-N-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56593800) has the molecular formula C15H22N4O4S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N',4-diethyl-N-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N',4-diethyl-N-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 56593800 |
| Molecular Formula | C15H22N4O4S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N',4-diethyl-N-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1ccc(S(C)(=O)=O)cc1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C15H22N4O4S2/c1-4-12-10-17-19(11-12)15(16-5-2)18-25(22,23)14-8-6-13(7-9-14)24(3,20)21/h6-10,12H,4-5,11H2,1-3H3,(H,16,18) |
| InChIKey | PHNWAFRFMSGIGQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|