C21H36N2 — CID 56593862
(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-aminoethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 56593862) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-aminoethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-aminoethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 56593862 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-aminoethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | C[C@@H](N)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@@H](N)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H36N2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12-13,15-19H,4-11,22-23H2,1-3H3/t13-,15+,16+,17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | SAEILLXFGWMNLW-NFJVIFTASA-N |
| XLogP | 4.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|