About N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine
N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine (PubChem CID 56594072) has the molecular formula C25H32FN3O
and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine |
| PubChem CID | 56594072 |
| Molecular Formula | C25H32FN3O |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine |
| SMILES | CCC(CC)c1ccc2c(NCCCNCc3cc(F)ccc3OC)ccnc2c1 |
| InChI | InChI=1S/C25H32FN3O/c1-4-18(5-2)19-7-9-22-23(11-14-29-24(22)16-19)28-13-6-12-27-17-20-15-21(26)8-10-25(20)30-3/h7-11,14-16,18,27H,4-6,12-13,17H2,1-3H3,(H,28,29) |
| InChIKey | FHWJMQNNVXSVKX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine?
The IUPAC name of N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine (CID 56594072) is N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine?
The canonical SMILES for N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine is CCC(CC)c1ccc2c(NCCCNCc3cc(F)ccc3OC)ccnc2c1.
What is the InChIKey of N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine?
The InChIKey is FHWJMQNNVXSVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32FN3O/c1-4-18(5-2)19-7-9-22-23(11-14-29-24(22)16-19)28-13-6-12-27-17-20-15-21(26)8-10-25(20)30-3/h7-11,14-16,18,27H,4-6,12-13,17H2,1-3H3,(H,28,29).
What are the key properties of N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine?
N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine has a molecular weight of 409.55 g/mol, XLogP of 5.88, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 56594072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).