C28H24F7N3O — CID 56594621
N'-[7-[3,5-bis(trifluoromethyl)phenyl]quinolin-4-yl]-N-[(5-fluoro-2-methoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 56594621) has the molecular formula C28H24F7N3O and a molecular weight of 551.51 g/mol. Its IUPAC name is N'-[7-[3,5-bis(trifluoromethyl)phenyl]quinolin-4-yl]-N-[(5-fluoro-2-methoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[7-[3,5-bis(trifluoromethyl)phenyl]quinolin-4-yl]-N-[(5-fluoro-2-methoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 56594621 |
| Molecular Formula | C28H24F7N3O |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | N'-[7-[3,5-bis(trifluoromethyl)phenyl]quinolin-4-yl]-N-[(5-fluoro-2-methoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1ccc(F)cc1CNCCCNc1ccnc2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc12 |
| InChI | InChI=1S/C28H24F7N3O/c1-39-26-6-4-22(29)13-19(26)16-36-8-2-9-37-24-7-10-38-25-14-17(3-5-23(24)25)18-11-20(27(30,31)32)15-21(12-18)28(33,34)35/h3-7,10-15,36H,2,8-9,16H2,1H3,(H,37,38) |
| InChIKey | PWUOMUXSGIGTMZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|