C12H16N5O2+ — CID 56594702
(6aR,10aS)-1,8,9-trimethyl-10a-nitro-7,10-dihydro-6aH-tetrazolo[5,1-a]isoquinolin-1-ium (PubChem CID 56594702) has the molecular formula C12H16N5O2+ and a molecular weight of 262.29 g/mol. Its IUPAC name is (6aR,10aS)-1,8,9-trimethyl-10a-nitro-7,10-dihydro-6aH-tetrazolo[5,1-a]isoquinolin-1-ium.
| Compound Name | (6aR,10aS)-1,8,9-trimethyl-10a-nitro-7,10-dihydro-6aH-tetrazolo[5,1-a]isoquinolin-1-ium |
|---|---|
| PubChem CID | 56594702 |
| Molecular Formula | C12H16N5O2+ |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (6aR,10aS)-1,8,9-trimethyl-10a-nitro-7,10-dihydro-6aH-tetrazolo[5,1-a]isoquinolin-1-ium |
| SMILES | CC1=C(C)C[C@@]2([N+](=O)[O-])c3n(nn[n+]3C)C=C[C@H]2C1 |
| InChI | InChI=1S/C12H16N5O2/c1-8-6-10-4-5-16-11(15(3)13-14-16)12(10,17(18)19)7-9(8)2/h4-5,10H,6-7H2,1-3H3/q+1/t10-,12-/m0/s1 |
| InChIKey | FWVUMRLMOZNULX-JQWIXIFHSA-N |
| XLogP | 0.81 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|