C21H22N6O — CID 56594790
1-(cyclohexylamino)-7-(1H-pyrazol-5-yl)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 56594790) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-(cyclohexylamino)-7-(1H-pyrazol-5-yl)-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-(cyclohexylamino)-7-(1H-pyrazol-5-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 56594790 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-(cyclohexylamino)-7-(1H-pyrazol-5-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCCCC2)c2c1[nH]c1cc(-c3ccn[nH]3)ccc12 |
| InChI | InChI=1S/C21H22N6O/c22-20(28)15-11-23-21(25-13-4-2-1-3-5-13)18-14-7-6-12(16-8-9-24-27-16)10-17(14)26-19(15)18/h6-11,13,26H,1-5H2,(H2,22,28)(H,23,25)(H,24,27) |
| InChIKey | HCVISALGHUEHJA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |