C19H32O2Si — CID 56594957
(5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethylspiro[4.5]deca-3,9-diene-4-carbaldehyde (PubChem CID 56594957) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethylspiro[4.5]deca-3,9-diene-4-carbaldehyde.
| Compound Name | (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethylspiro[4.5]deca-3,9-diene-4-carbaldehyde |
|---|---|
| PubChem CID | 56594957 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethylspiro[4.5]deca-3,9-diene-4-carbaldehyde |
| SMILES | CC1=CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]12CCC(C)=C2C=O |
| InChI | InChI=1S/C19H32O2Si/c1-14-11-12-19(16(14)13-20)15(2)9-8-10-17(19)21-22(6,7)18(3,4)5/h9,13,17H,8,10-12H2,1-7H3/t17-,19-/m0/s1 |
| InChIKey | LQUMQURQOVIELL-HKUYNNGSSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|