C14H23NO5 — CID 56595232
ethyl (1S,2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate (PubChem CID 56595232) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl (1S,2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 56595232 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | ethyl (1S,2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](O)C=C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO5/c1-5-19-12(17)10-8-9(16)6-7-11(10)15-13(18)20-14(2,3)4/h6-7,9-11,16H,5,8H2,1-4H3,(H,15,18)/t9-,10+,11+/m1/s1 |
| InChIKey | GABGSLJKOUQHEV-VWYCJHECSA-N |
| XLogP | 1.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|