C14H20N4O2S — CID 56595280
N-(benzenesulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56595280) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-(benzenesulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 56595280 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(benzenesulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1ccccc1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C14H20N4O2S/c1-3-12-10-16-18(11-12)14(15-4-2)17-21(19,20)13-8-6-5-7-9-13/h5-10,12H,3-4,11H2,1-2H3,(H,15,17) |
| InChIKey | VNEUIKGLJZGLRD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|