About N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide
N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56595403) has the molecular formula C15H21ClN4O2S
and a molecular weight of 356.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide |
| PubChem CID | 56595403 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCC/N=C(/NS(=O)(=O)c1cccc(Cl)c1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C15H21ClN4O2S/c1-3-8-17-15(20-11-12(4-2)10-18-20)19-23(21,22)14-7-5-6-13(16)9-14/h5-7,9-10,12H,3-4,8,11H2,1-2H3,(H,17,19) |
| InChIKey | ILAOCYKAWDFLKV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide?
The IUPAC name of N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide (CID 56595403) is N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide.
What is the SMILES notation for N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide?
The canonical SMILES for N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide is CCC/N=C(/NS(=O)(=O)c1cccc(Cl)c1)N1CC(CC)C=N1.
What is the InChIKey of N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide?
The InChIKey is ILAOCYKAWDFLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN4O2S/c1-3-8-17-15(20-11-12(4-2)10-18-20)19-23(21,22)14-7-5-6-13(16)9-14/h5-7,9-10,12H,3-4,8,11H2,1-2H3,(H,17,19).
What are the key properties of N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide?
N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide has a molecular weight of 356.88 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)sulfonyl-4-ethyl-N'-propyl-3,4-dihydropyrazole-2-carboximidamide is sourced from PubChem (CID 56595403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).