About [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride
[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride (PubChem CID 56595438) has the molecular formula C13H16ClN3O3
and a molecular weight of 297.74 g/mol. Its IUPAC name is [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride |
| PubChem CID | 56595438 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride |
| SMILES | Cl.OCc1cc(-c2cncc(OC[C@@H]3CCN3)c2)on1 |
| InChI | InChI=1S/C13H15N3O3.ClH/c17-7-11-4-13(19-16-11)9-3-12(6-14-5-9)18-8-10-1-2-15-10;/h3-6,10,15,17H,1-2,7-8H2;1H/t10-;/m0./s1 |
| InChIKey | OSMWLOMSZHOPDK-PPHPATTJSA-N |
| XLogP | 1.39 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride?
The IUPAC name of [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride (CID 56595438) is [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride.
What is the SMILES notation for [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride?
The canonical SMILES for [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride is Cl.OCc1cc(-c2cncc(OC[C@@H]3CCN3)c2)on1.
What is the InChIKey of [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride?
The InChIKey is OSMWLOMSZHOPDK-PPHPATTJSA-N. The full InChI is InChI=1S/C13H15N3O3.ClH/c17-7-11-4-13(19-16-11)9-3-12(6-14-5-9)18-8-10-1-2-15-10;/h3-6,10,15,17H,1-2,7-8H2;1H/t10-;/m0./s1.
What are the key properties of [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride?
[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride has a molecular weight of 297.74 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]methanol;hydrochloride is sourced from PubChem (CID 56595438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).