C22H28O4 — CID 56595469
(3S,3aS,6aS,10R,10aR)-10-hydroxy-7,7-dimethyl-4-methylidene-3-phenylmethoxy-3,3a,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one (PubChem CID 56595469) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (3S,3aS,6aS,10R,10aR)-10-hydroxy-7,7-dimethyl-4-methylidene-3-phenylmethoxy-3,3a,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one.
| Compound Name | (3S,3aS,6aS,10R,10aR)-10-hydroxy-7,7-dimethyl-4-methylidene-3-phenylmethoxy-3,3a,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one |
|---|---|
| PubChem CID | 56595469 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (3S,3aS,6aS,10R,10aR)-10-hydroxy-7,7-dimethyl-4-methylidene-3-phenylmethoxy-3,3a,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one |
| SMILES | C=C1CC[C@H]2C(C)(C)CC[C@@H](O)[C@@]23C(=O)O[C@H](OCc2ccccc2)[C@@H]13 |
| InChI | InChI=1S/C22H28O4/c1-14-9-10-16-21(2,3)12-11-17(23)22(16)18(14)19(26-20(22)24)25-13-15-7-5-4-6-8-15/h4-8,16-19,23H,1,9-13H2,2-3H3/t16-,17+,18+,19-,22-/m0/s1 |
| InChIKey | LETOBZDRLOYGKR-TZDBLYRBSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|