C23H42O4Si — CID 56595614
[(1R,2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enyl]-3-hydroxy-2-methyl-6-methylidenecyclohexyl]methyl acetate (PubChem CID 56595614) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is [(1R,2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enyl]-3-hydroxy-2-methyl-6-methylidenecyclohexyl]methyl acetate.
| Compound Name | [(1R,2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enyl]-3-hydroxy-2-methyl-6-methylidenecyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 56595614 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | [(1R,2S,3S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enyl]-3-hydroxy-2-methyl-6-methylidenecyclohexyl]methyl acetate |
| SMILES | C=C(C)C(CC[C@@]1(C)[C@H](COC(C)=O)C(=C)CC[C@@H]1O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O4Si/c1-16(2)20(27-28(9,10)22(5,6)7)13-14-23(8)19(15-26-18(4)24)17(3)11-12-21(23)25/h19-21,25H,1,3,11-15H2,2,4-10H3/t19-,20?,21+,23+/m1/s1 |
| InChIKey | CNANOEJXBFXOIM-WRJLQGCZSA-N |
| XLogP | 5.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|