C16H24O3 — CID 56595624
(2R,3aS,7aR)-2-(2-hydroxypropan-2-yl)-6-(3-methylbut-2-enyl)-3,3a,4,7a-tetrahydro-2H-1-benzofuran-5-one (PubChem CID 56595624) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2R,3aS,7aR)-2-(2-hydroxypropan-2-yl)-6-(3-methylbut-2-enyl)-3,3a,4,7a-tetrahydro-2H-1-benzofuran-5-one.
| Compound Name | (2R,3aS,7aR)-2-(2-hydroxypropan-2-yl)-6-(3-methylbut-2-enyl)-3,3a,4,7a-tetrahydro-2H-1-benzofuran-5-one |
|---|---|
| PubChem CID | 56595624 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,3aS,7aR)-2-(2-hydroxypropan-2-yl)-6-(3-methylbut-2-enyl)-3,3a,4,7a-tetrahydro-2H-1-benzofuran-5-one |
| SMILES | CC(C)=CCC1=C[C@@H]2O[C@@H](C(C)(C)O)C[C@H]2CC1=O |
| InChI | InChI=1S/C16H24O3/c1-10(2)5-6-11-8-14-12(7-13(11)17)9-15(19-14)16(3,4)18/h5,8,12,14-15,18H,6-7,9H2,1-4H3/t12-,14+,15-/m1/s1 |
| InChIKey | HNJIEOWISAFAKD-VHDGCEQUSA-N |
| XLogP | 2.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|