C14H24O2 — CID 56595630
methyl (1R,2R,5R)-2-methyl-5-propan-2-yl-1-prop-2-enylcyclopentane-1-carboxylate (PubChem CID 56595630) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is methyl (1R,2R,5R)-2-methyl-5-propan-2-yl-1-prop-2-enylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,5R)-2-methyl-5-propan-2-yl-1-prop-2-enylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 56595630 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | methyl (1R,2R,5R)-2-methyl-5-propan-2-yl-1-prop-2-enylcyclopentane-1-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC)[C@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C14H24O2/c1-6-9-14(13(15)16-5)11(4)7-8-12(14)10(2)3/h6,10-12H,1,7-9H2,2-5H3/t11-,12-,14-/m1/s1 |
| InChIKey | PQWARDVVQFJEPO-YRGRVCCFSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|