C14H19ClN4O2S — CID 56595666
N-(4-chlorophenyl)sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56595666) has the molecular formula C14H19ClN4O2S and a molecular weight of 342.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 56595666 |
| Molecular Formula | C14H19ClN4O2S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C14H19ClN4O2S/c1-3-11-9-17-19(10-11)14(16-4-2)18-22(20,21)13-7-5-12(15)6-8-13/h5-9,11H,3-4,10H2,1-2H3,(H,16,18) |
| InChIKey | RMRMGNRTOXJZLL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|