C15H19F3N4O2S — CID 56595668
N',4-diethyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56595668) has the molecular formula C15H19F3N4O2S and a molecular weight of 376.40 g/mol. Its IUPAC name is N',4-diethyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N',4-diethyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 56595668 |
| Molecular Formula | C15H19F3N4O2S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N',4-diethyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1cccc(C(F)(F)F)c1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C15H19F3N4O2S/c1-3-11-9-20-22(10-11)14(19-4-2)21-25(23,24)13-7-5-6-12(8-13)15(16,17)18/h5-9,11H,3-4,10H2,1-2H3,(H,19,21) |
| InChIKey | MUXQJHWPMFQURI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|