C31H30F5N5O5 — CID 56595989
2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid (PubChem CID 56595989) has the molecular formula C31H30F5N5O5 and a molecular weight of 647.60 g/mol. Its IUPAC name is 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 56595989 |
| Molecular Formula | C31H30F5N5O5 |
| Molecular Weight | 647.60 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(C2CCCCC2)cc1)c1nc(Oc2c(F)c(F)c(F)c(F)c2F)c2ncn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C31H30F5N5O5/c1-31(2,3)46-30(44)41(13-16-9-11-18(12-10-16)17-7-5-4-6-8-17)29-38-27-25(37-15-40(27)14-19(42)43)28(39-29)45-26-23(35)21(33)20(32)22(34)24(26)36/h9-12,15,17H,4-8,13-14H2,1-3H3,(H,42,43) |
| InChIKey | ITPMUUWJLMEPQV-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.60 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|