About 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide
4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide (PubChem CID 56596390) has the molecular formula C19H28Cl2N2O
and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide.
Molecular Properties
| Compound Name | 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide |
| PubChem CID | 56596390 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide |
| SMILES | CC(C)C[C@H](NCCCC(N)=O)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C19H28Cl2N2O/c1-13(2)11-17(23-10-3-5-18(22)24)19(8-4-9-19)14-6-7-15(20)16(21)12-14/h6-7,12-13,17,23H,3-5,8-11H2,1-2H3,(H2,22,24)/t17-/m0/s1 |
| InChIKey | LOAMESGVVPSFCK-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide?
The IUPAC name of 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide (CID 56596390) is 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide.
What is the SMILES notation for 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide?
The canonical SMILES for 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide is CC(C)C[C@H](NCCCC(N)=O)C1(c2ccc(Cl)c(Cl)c2)CCC1.
What is the InChIKey of 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide?
The InChIKey is LOAMESGVVPSFCK-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H28Cl2N2O/c1-13(2)11-17(23-10-3-5-18(22)24)19(8-4-9-19)14-6-7-15(20)16(21)12-14/h6-7,12-13,17,23H,3-5,8-11H2,1-2H3,(H2,22,24)/t17-/m0/s1.
What are the key properties of 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide?
4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide has a molecular weight of 371.35 g/mol, XLogP of 4.68, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S)-1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]butanamide is sourced from PubChem (CID 56596390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).