C25H27NO5 — CID 56596412
2-[3-[[6-(1-hydroxyhexyl)naphthalene-1-carbonyl]amino]phenoxy]acetic acid (PubChem CID 56596412) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-[3-[[6-(1-hydroxyhexyl)naphthalene-1-carbonyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-[[6-(1-hydroxyhexyl)naphthalene-1-carbonyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 56596412 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[3-[[6-(1-hydroxyhexyl)naphthalene-1-carbonyl]amino]phenoxy]acetic acid |
| SMILES | CCCCCC(O)c1ccc2c(C(=O)Nc3cccc(OCC(=O)O)c3)cccc2c1 |
| InChI | InChI=1S/C25H27NO5/c1-2-3-4-11-23(27)18-12-13-21-17(14-18)7-5-10-22(21)25(30)26-19-8-6-9-20(15-19)31-16-24(28)29/h5-10,12-15,23,27H,2-4,11,16H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | ZAVFPSJWPMIFOT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|