C20H14F3N7O — CID 56597210
3-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 56597210) has the molecular formula C20H14F3N7O and a molecular weight of 425.37 g/mol. Its IUPAC name is 3-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 56597210 |
| Molecular Formula | C20H14F3N7O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3-[1-[(2,3-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nn(Cc4cccc(F)c4F)c4ncc(F)cc34)nnc21 |
| InChI | InChI=1S/C20H14F3N7O/c1-20(2)15-17(26-19(20)31)25-16(28-27-15)14-11-6-10(21)7-24-18(11)30(29-14)8-9-4-3-5-12(22)13(9)23/h3-7H,8H2,1-2H3,(H,25,26,28,31) |
| InChIKey | PHPZNBFARXDEDD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |