C20H13F4N7O — CID 56597347
3-[5-fluoro-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 56597347) has the molecular formula C20H13F4N7O and a molecular weight of 443.36 g/mol. Its IUPAC name is 3-[5-fluoro-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[5-fluoro-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 56597347 |
| Molecular Formula | C20H13F4N7O |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-[5-fluoro-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nn(Cc4c(F)ccc(F)c4F)c4ncc(F)cc34)nnc21 |
| InChI | InChI=1S/C20H13F4N7O/c1-20(2)15-17(27-19(20)32)26-16(29-28-15)14-9-5-8(21)6-25-18(9)31(30-14)7-10-11(22)3-4-12(23)13(10)24/h3-6H,7H2,1-2H3,(H,26,27,29,32) |
| InChIKey | ZJEBAKIUANUEJV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|