About [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate
[3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate (PubChem CID 56597859) has the molecular formula C25H15F3N2O4S
and a molecular weight of 496.47 g/mol. Its IUPAC name is [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate |
| PubChem CID | 56597859 |
| Molecular Formula | C25H15F3N2O4S |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Oc2cccc(-c3c(C#N)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C25H15F3N2O4S/c1-35(32,33)19-8-3-6-16(12-19)24(31)34-18-7-2-5-15(11-18)22-17(13-29)14-30-23-20(22)9-4-10-21(23)25(26,27)28/h2-12,14H,1H3 |
| InChIKey | LOSPOFRUBFNPFU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate?
The IUPAC name of [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate (CID 56597859) is [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate.
What is the SMILES notation for [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate?
The canonical SMILES for [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate is CS(=O)(=O)c1cccc(C(=O)Oc2cccc(-c3c(C#N)cnc4c(C(F)(F)F)cccc34)c2)c1.
What is the InChIKey of [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate?
The InChIKey is LOSPOFRUBFNPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15F3N2O4S/c1-35(32,33)19-8-3-6-16(12-19)24(31)34-18-7-2-5-15(11-18)22-17(13-29)14-30-23-20(22)9-4-10-21(23)25(26,27)28/h2-12,14H,1H3.
What are the key properties of [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate?
[3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate has a molecular weight of 496.47 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-cyano-8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate is sourced from PubChem (CID 56597859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).