C19H17F7O3 — CID 56598103
[2,3,5,6-tetrafluoro-4-(2-oxopropyl)phenyl]methyl (1S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 56598103) has the molecular formula C19H17F7O3 and a molecular weight of 426.33 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2-oxopropyl)phenyl]methyl (1S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2-oxopropyl)phenyl]methyl (1S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 56598103 |
| Molecular Formula | C19H17F7O3 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2-oxopropyl)phenyl]methyl (1S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | CC(=O)Cc1c(F)c(F)c(COC(=O)[C@H]2C(/C=C/C(F)(F)F)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C19H17F7O3/c1-8(27)6-9-13(20)15(22)10(16(23)14(9)21)7-29-17(28)12-11(18(12,2)3)4-5-19(24,25)26/h4-5,11-12H,6-7H2,1-3H3/b5-4+/t11?,12-/m1/s1 |
| InChIKey | RIXFQPLQBBLVST-XQCSSWMESA-N |
| XLogP | 4.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|