C19H11FN6O2 — CID 56598243
2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5,6-dione (PubChem CID 56598243) has the molecular formula C19H11FN6O2 and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5,6-dione.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5,6-dione |
|---|---|
| PubChem CID | 56598243 |
| Molecular Formula | C19H11FN6O2 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5,6-dione |
| SMILES | O=C1Nc2nc(-c3nn(Cc4ccccc4F)c4ncccc34)ncc2C1=O |
| InChI | InChI=1S/C19H11FN6O2/c20-13-6-2-1-4-10(13)9-26-18-11(5-3-7-21-18)14(25-26)17-22-8-12-15(27)19(28)24-16(12)23-17/h1-8H,9H2,(H,22,23,24,27,28) |
| InChIKey | RYCLGGZZBDAFER-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|