C28H27MgN3O11+2 — CID 56598300
magnesium;(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 56598300) has the molecular formula C28H27MgN3O11+2 and a molecular weight of 605.84 g/mol. Its IUPAC name is magnesium;(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | magnesium;(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 56598300 |
| Molecular Formula | C28H27MgN3O11+2 |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | magnesium;(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN1CC(=O)N2[C@H](c3ccc4c(c3)OCO4)c3[nH]c4ccccc4c3C[C@@H]2C1=O.O=C(O)CC(O)(CC(=O)O)C(=O)O.[Mg+2] |
| InChI | InChI=1S/C22H19N3O4.C6H8O7.Mg/c1-24-10-19(26)25-16(22(24)27)9-14-13-4-2-3-5-15(13)23-20(14)21(25)12-6-7-17-18(8-12)29-11-28-17;7-3(8)1-6(13,5(11)12)2-4(9)10;/h2-8,16,21,23H,9-11H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+2/t16-,21-;;/m1../s1 |
| InChIKey | SSYAPQDVYAPVQL-VHXSFILTSA-N |
| XLogP | 0.58 |
| TPSA | 207.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|