C35H54O11 — CID 56598604
(2E,4E,8R,14S,18S,19R)-4-ethyl-6,13,17-trihydroxy-19-[3-hydroxy-3-(4-methyl-5-methylidene-2-oxofuran-3-yl)propanoyl]oxy-8,10,14,18-tetramethyl-15-oxoicosa-2,4-dienoic acid (PubChem CID 56598604) has the molecular formula C35H54O11 and a molecular weight of 650.81 g/mol. Its IUPAC name is (2E,4E,8R,14S,18S,19R)-4-ethyl-6,13,17-trihydroxy-19-[3-hydroxy-3-(4-methyl-5-methylidene-2-oxofuran-3-yl)propanoyl]oxy-8,10,14,18-tetramethyl-15-oxoicosa-2,4-dienoic acid.
| Compound Name | (2E,4E,8R,14S,18S,19R)-4-ethyl-6,13,17-trihydroxy-19-[3-hydroxy-3-(4-methyl-5-methylidene-2-oxofuran-3-yl)propanoyl]oxy-8,10,14,18-tetramethyl-15-oxoicosa-2,4-dienoic acid |
|---|---|
| PubChem CID | 56598604 |
| Molecular Formula | C35H54O11 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | (2E,4E,8R,14S,18S,19R)-4-ethyl-6,13,17-trihydroxy-19-[3-hydroxy-3-(4-methyl-5-methylidene-2-oxofuran-3-yl)propanoyl]oxy-8,10,14,18-tetramethyl-15-oxoicosa-2,4-dienoic acid |
| SMILES | C=C1OC(=O)C(C(O)CC(=O)O[C@H](C)[C@@H](C)C(O)CC(=O)[C@@H](C)C(O)CCC(C)C[C@@H](C)CC(O)/C=C(/C=C/C(=O)O)CC)=C1C |
| InChI | InChI=1S/C35H54O11/c1-9-26(11-13-32(41)42)16-27(36)15-20(3)14-19(2)10-12-28(37)23(6)30(39)17-29(38)21(4)24(7)45-33(43)18-31(40)34-22(5)25(8)46-35(34)44/h11,13,16,19-21,23-24,27-29,31,36-38,40H,8-10,12,14-15,17-18H2,1-7H3,(H,41,42)/b13-11+,26-16+/t19?,20-,21-,23+,24-,27?,28?,29?,31?/m1/s1 |
| InChIKey | WWJSXHZEUXPOPR-ZFKXYIHCSA-N |
| XLogP | 4.18 |
| TPSA | 187.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|