C24H18F2N4O — CID 56598758
5-(3-fluorophenyl)-N-[[6-(2-fluoro-4-pyridinyl)-5-methyl-3-pyridinyl]methyl]pyridine-2-carboxamide (PubChem CID 56598758) has the molecular formula C24H18F2N4O and a molecular weight of 416.43 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-N-[[6-(2-fluoro-4-pyridinyl)-5-methyl-3-pyridinyl]methyl]pyridine-2-carboxamide.
| Compound Name | 5-(3-fluorophenyl)-N-[[6-(2-fluoro-4-pyridinyl)-5-methyl-3-pyridinyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56598758 |
| Molecular Formula | C24H18F2N4O |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-(3-fluorophenyl)-N-[[6-(2-fluoro-4-pyridinyl)-5-methyl-3-pyridinyl]methyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2ccc(-c3cccc(F)c3)cn2)cnc1-c1ccnc(F)c1 |
| InChI | InChI=1S/C24H18F2N4O/c1-15-9-16(12-29-23(15)18-7-8-27-22(26)11-18)13-30-24(31)21-6-5-19(14-28-21)17-3-2-4-20(25)10-17/h2-12,14H,13H2,1H3,(H,30,31) |
| InChIKey | JBRZRNDVFOEXAX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|