C27H42N6O8 — CID 56599151
(3S)-3-acetamido-4-[[2-[[2-[[(2S)-1-[(3-carbamoyl-1-adamantyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid (PubChem CID 56599151) has the molecular formula C27H42N6O8 and a molecular weight of 578.67 g/mol. Its IUPAC name is (3S)-3-acetamido-4-[[2-[[2-[[(2S)-1-[(3-carbamoyl-1-adamantyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-acetamido-4-[[2-[[2-[[(2S)-1-[(3-carbamoyl-1-adamantyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 56599151 |
| Molecular Formula | C27H42N6O8 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (3S)-3-acetamido-4-[[2-[[2-[[(2S)-1-[(3-carbamoyl-1-adamantyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NC12CC3CC(C1)CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C27H42N6O8/c1-14(2)4-18(24(40)33-27-9-16-5-17(10-27)8-26(7-16,13-27)25(28)41)32-21(36)12-29-20(35)11-30-23(39)19(6-22(37)38)31-15(3)34/h14,16-19H,4-13H2,1-3H3,(H2,28,41)(H,29,35)(H,30,39)(H,31,34)(H,32,36)(H,33,40)(H,37,38)/t16?,17?,18-,19-,26?,27?/m0/s1 |
| InChIKey | LUJZBZPLIRWWGJ-ZKHAZHQOSA-N |
| XLogP | -1.33 |
| TPSA | 225.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |