C24H28ClN9O4S — CID 56599168
N-[2-[(2S)-2-[5-[(3S,4R)-3-azido-4-hydroxypyrrolidin-1-yl]-6-methylpyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carbonyl]-4-chlorophenyl]methanesulfonamide (PubChem CID 56599168) has the molecular formula C24H28ClN9O4S and a molecular weight of 574.07 g/mol. Its IUPAC name is N-[2-[(2S)-2-[5-[(3S,4R)-3-azido-4-hydroxypyrrolidin-1-yl]-6-methylpyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carbonyl]-4-chlorophenyl]methanesulfonamide.
| Compound Name | N-[2-[(2S)-2-[5-[(3S,4R)-3-azido-4-hydroxypyrrolidin-1-yl]-6-methylpyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carbonyl]-4-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 56599168 |
| Molecular Formula | C24H28ClN9O4S |
| Molecular Weight | 574.07 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | N-[2-[(2S)-2-[5-[(3S,4R)-3-azido-4-hydroxypyrrolidin-1-yl]-6-methylpyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carbonyl]-4-chlorophenyl]methanesulfonamide |
| SMILES | Cc1cn2nc([C@@H]3CCCCN3C(=O)c3cc(Cl)ccc3NS(C)(=O)=O)cc2nc1N1C[C@@H](O)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C24H28ClN9O4S/c1-14-11-34-22(27-23(14)32-12-19(28-31-26)21(35)13-32)10-18(29-34)20-5-3-4-8-33(20)24(36)16-9-15(25)6-7-17(16)30-39(2,37)38/h6-7,9-11,19-21,30,35H,3-5,8,12-13H2,1-2H3/t19-,20-,21+/m0/s1 |
| InChIKey | DEXHCSKTDMCHNY-PCCBWWKXSA-N |
| XLogP | 3.29 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|