About N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine
N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 565992) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 565992 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)n(CNc2nccs2)n1 |
| InChI | InChI=1S/C9H12N4S/c1-7-5-8(2)13(12-7)6-11-9-10-3-4-14-9/h3-5H,6H2,1-2H3,(H,10,11) |
| InChIKey | SBUOEMVPDZVZKJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine (CID 565992) is N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine is Cc1cc(C)n(CNc2nccs2)n1.
What is the InChIKey of N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine?
The InChIKey is SBUOEMVPDZVZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-7-5-8(2)13(12-7)6-11-9-10-3-4-14-9/h3-5H,6H2,1-2H3,(H,10,11).
What are the key properties of N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine?
N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine has a molecular weight of 208.29 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 565992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).