C28H36N4O2 — CID 56599310
(E)-N-[2,2-dimethyl-3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine (PubChem CID 56599310) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is (E)-N-[2,2-dimethyl-3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine.
| Compound Name | (E)-N-[2,2-dimethyl-3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine |
|---|---|
| PubChem CID | 56599310 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (E)-N-[2,2-dimethyl-3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine |
| SMILES | Cc1ccc2c(n1)/C(=N/OCC(C)(C)CO/N=C1\CCCc3cc4c(nc31)CCCC4)CCC2 |
| InChI | InChI=1S/C28H36N4O2/c1-19-14-15-20-9-6-12-24(26(20)29-19)31-33-17-28(2,3)18-34-32-25-13-7-10-22-16-21-8-4-5-11-23(21)30-27(22)25/h14-16H,4-13,17-18H2,1-3H3/b31-24+,32-25+ |
| InChIKey | CFMKNTNCUFASGI-UXPPBCCBSA-N |
| XLogP | 5.50 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|