C24H18ClF3N4O4 — CID 56599740
N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(3-cyano-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 56599740) has the molecular formula C24H18ClF3N4O4 and a molecular weight of 518.88 g/mol. Its IUPAC name is N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(3-cyano-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(3-cyano-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56599740 |
| Molecular Formula | C24H18ClF3N4O4 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(3-cyano-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | N#Cc1ccc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](O)[C@H](O)[C@@H](CCl)O3)ccc2F)c1F |
| InChI | InChI=1S/C24H18ClF3N4O4/c25-8-19-23(34)17(33)7-18(36-19)12-5-6-30-10-16(12)32-24(35)15-4-3-14(27)22(31-15)20-13(26)2-1-11(9-29)21(20)28/h1-6,10,17-19,23,33-34H,7-8H2,(H,32,35)/t17-,18-,19-,23+/m1/s1 |
| InChIKey | ONFZUVREBYOYPA-ZQAYVECASA-N |
| XLogP | 3.48 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|