C25H21F3N4O4 — CID 56599741
6-(3-cyano-2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 56599741) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 6-(3-cyano-2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(3-cyano-2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56599741 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 6-(3-cyano-2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CC[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)ccc(C#N)c3F)n2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H21F3N4O4/c1-2-19-24(34)18(33)9-20(36-19)13-7-8-30-11-17(13)32-25(35)16-6-5-15(27)23(31-16)21-14(26)4-3-12(10-29)22(21)28/h3-8,11,18-20,24,33-34H,2,9H2,1H3,(H,32,35)/t18-,19-,20-,24+/m1/s1 |
| InChIKey | TZYKWLFCHBXMBE-FIXDAVPBSA-N |
| XLogP | 3.65 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |