C23H18F3N5O4 — CID 56599743
3-amino-N-[4-[(2R,4R,5S,6R)-6-cyano-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 56599743) has the molecular formula C23H18F3N5O4 and a molecular weight of 485.42 g/mol. Its IUPAC name is 3-amino-N-[4-[(2R,4R,5S,6R)-6-cyano-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | 3-amino-N-[4-[(2R,4R,5S,6R)-6-cyano-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56599743 |
| Molecular Formula | C23H18F3N5O4 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-amino-N-[4-[(2R,4R,5S,6R)-6-cyano-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | N#C[C@H]1O[C@@H](c2ccncc2NC(=O)c2nc(-c3c(F)cccc3F)c(F)cc2N)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H18F3N5O4/c24-11-2-1-3-12(25)19(11)20-13(26)6-14(28)21(31-20)23(34)30-15-9-29-5-4-10(15)17-7-16(32)22(33)18(8-27)35-17/h1-6,9,16-18,22,32-33H,7,28H2,(H,30,34)/t16-,17-,18-,22+/m1/s1 |
| InChIKey | INIOGZKMXWSTOC-IDVKNYFZSA-N |
| XLogP | 2.47 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |