C22H17N7O — CID 56600061
4-[(4-amino-6-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-[3-[(E)-2-cyanoethenyl]phenoxy]benzonitrile (PubChem CID 56600061) has the molecular formula C22H17N7O and a molecular weight of 395.43 g/mol. Its IUPAC name is 4-[(4-amino-6-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-[3-[(E)-2-cyanoethenyl]phenoxy]benzonitrile.
| Compound Name | 4-[(4-amino-6-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-[3-[(E)-2-cyanoethenyl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 56600061 |
| Molecular Formula | C22H17N7O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[(4-amino-6-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-[3-[(E)-2-cyanoethenyl]phenoxy]benzonitrile |
| SMILES | N#C/C=C/c1cccc(Oc2cc(Nc3nc(N)nc(C4CC4)n3)ccc2C#N)c1 |
| InChI | InChI=1S/C22H17N7O/c23-10-2-4-14-3-1-5-18(11-14)30-19-12-17(9-8-16(19)13-24)26-22-28-20(15-6-7-15)27-21(25)29-22/h1-5,8-9,11-12,15H,6-7H2,(H3,25,26,27,28,29)/b4-2+ |
| InChIKey | AMEGFBPUWXJNSC-DUXPYHPUSA-N |
| XLogP | 4.28 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|