C25H24F3N3O4 — CID 56600143
6-(2,6-difluorophenyl)-N-[4-[(2S,4S,5R,6S)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 56600143) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-N-[4-[(2S,4S,5R,6S)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-N-[4-[(2S,4S,5R,6S)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56600143 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 6-(2,6-difluorophenyl)-N-[4-[(2S,4S,5R,6S)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CC[C@]1(O)[C@H](C)O[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H]1O |
| InChI | InChI=1S/C25H24F3N3O4/c1-3-25(34)13(2)35-20(11-21(25)32)14-9-10-29-12-19(14)31-24(33)18-8-7-17(28)23(30-18)22-15(26)5-4-6-16(22)27/h4-10,12-13,20-21,32,34H,3,11H2,1-2H3,(H,31,33)/t13-,20-,21-,25-/m0/s1 |
| InChIKey | YGDAFAOBFZYAQD-YQWYTTOOSA-N |
| XLogP | 4.17 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |