C25H50O5Si2 — CID 56600292
tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-prop-2-enoxyprop-1-enyl]-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane (PubChem CID 56600292) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-prop-2-enoxyprop-1-enyl]-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-prop-2-enoxyprop-1-enyl]-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 56600292 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-prop-2-enoxyprop-1-enyl]-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
| SMILES | C=CCOC/C=C\[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-14-17-26-18-15-16-20-22(29-25(8,9)28-20)21(30-32(12,13)24(5,6)7)19-27-31(10,11)23(2,3)4/h14-16,20-22H,1,17-19H2,2-13H3/b16-15-/t20-,21+,22-/m0/s1 |
| InChIKey | LFCGXFMXCSFAIF-YVTKHUKNSA-N |
| XLogP | 6.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|