C24H19F4N3O4 — CID 56600538
6-(2,6-difluorophenyl)-5-fluoro-N-[4-[(2S,3S,5R,6R)-3-fluoro-5-hydroxy-5,6-dimethyl-4-oxooxan-2-yl]-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 56600538) has the molecular formula C24H19F4N3O4 and a molecular weight of 489.43 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-5-fluoro-N-[4-[(2S,3S,5R,6R)-3-fluoro-5-hydroxy-5,6-dimethyl-4-oxooxan-2-yl]-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-5-fluoro-N-[4-[(2S,3S,5R,6R)-3-fluoro-5-hydroxy-5,6-dimethyl-4-oxooxan-2-yl]-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56600538 |
| Molecular Formula | C24H19F4N3O4 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 6-(2,6-difluorophenyl)-5-fluoro-N-[4-[(2S,3S,5R,6R)-3-fluoro-5-hydroxy-5,6-dimethyl-4-oxooxan-2-yl]-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | C[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)[C@H](F)C(=O)[C@]1(C)O |
| InChI | InChI=1S/C24H19F4N3O4/c1-11-24(2,34)22(32)19(28)21(35-11)12-8-9-29-10-17(12)31-23(33)16-7-6-15(27)20(30-16)18-13(25)4-3-5-14(18)26/h3-11,19,21,34H,1-2H3,(H,31,33)/t11-,19+,21+,24-/m1/s1 |
| InChIKey | YLAVVUCJTVGBLO-IECBWXTMSA-N |
| XLogP | 3.93 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |