C28H25NO5 — CID 56600618
benzyl (2R,3S)-2-[(1R)-1-benzoyloxyethyl]-4-methylidene-5-oxo-3-phenylpyrrolidine-2-carboxylate (PubChem CID 56600618) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is benzyl (2R,3S)-2-[(1R)-1-benzoyloxyethyl]-4-methylidene-5-oxo-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R,3S)-2-[(1R)-1-benzoyloxyethyl]-4-methylidene-5-oxo-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56600618 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | benzyl (2R,3S)-2-[(1R)-1-benzoyloxyethyl]-4-methylidene-5-oxo-3-phenylpyrrolidine-2-carboxylate |
| SMILES | C=C1C(=O)N[C@@](C(=O)OCc2ccccc2)([C@@H](C)OC(=O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H25NO5/c1-19-24(22-14-8-4-9-15-22)28(29-25(19)30,27(32)33-18-21-12-6-3-7-13-21)20(2)34-26(31)23-16-10-5-11-17-23/h3-17,20,24H,1,18H2,2H3,(H,29,30)/t20-,24-,28+/m1/s1 |
| InChIKey | SQVQNDVAOBADLH-GDRRSRKRSA-N |
| XLogP | 4.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|