C11H9F4NO — CID 56601031
5-(2,2,3,3-tetrafluoropropoxy)-1H-indole (PubChem CID 56601031) has the molecular formula C11H9F4NO and a molecular weight of 247.19 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropoxy)-1H-indole.
| Compound Name | 5-(2,2,3,3-tetrafluoropropoxy)-1H-indole |
|---|---|
| PubChem CID | 56601031 |
| Molecular Formula | C11H9F4NO |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropoxy)-1H-indole |
| SMILES | FC(F)C(F)(F)COc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C11H9F4NO/c12-10(13)11(14,15)6-17-8-1-2-9-7(5-8)3-4-16-9/h1-5,10,16H,6H2 |
| InChIKey | OSJDNMSRGDHWJN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|