About 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide
1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 56601461) has the molecular formula C22H19N3O2
and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 56601461 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CC(=O)c1nc(C(=O)NCCc2ccccc2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C22H19N3O2/c1-14(26)20-21-17(16-9-5-6-10-18(16)24-21)13-19(25-20)22(27)23-12-11-15-7-3-2-4-8-15/h2-10,13,24H,11-12H2,1H3,(H,23,27) |
| InChIKey | QPUYCBSQXKSFOO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide (CID 56601461) is 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide is CC(=O)c1nc(C(=O)NCCc2ccccc2)cc2c1[nH]c1ccccc12.
What is the InChIKey of 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is QPUYCBSQXKSFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O2/c1-14(26)20-21-17(16-9-5-6-10-18(16)24-21)13-19(25-20)22(27)23-12-11-15-7-3-2-4-8-15/h2-10,13,24H,11-12H2,1H3,(H,23,27).
What are the key properties of 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 357.41 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-(2-phenylethyl)-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 56601461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).