C18H24F3N3O — CID 56601544
1-[1-(3,3-dimethylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine (PubChem CID 56601544) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-[1-(3,3-dimethylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(3,3-dimethylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 56601544 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[1-(3,3-dimethylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(OCc2cc(F)c(F)cc2F)n(CCC(C)(C)C)n1 |
| InChI | InChI=1S/C18H24F3N3O/c1-18(2,3)5-6-24-17(8-13(23-24)10-22-4)25-11-12-7-15(20)16(21)9-14(12)19/h7-9,22H,5-6,10-11H2,1-4H3 |
| InChIKey | PPLOKOOZNJZVJZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|