About 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone
1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone (PubChem CID 566018) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone |
| PubChem CID | 566018 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone |
| SMILES | CC(=O)C1=NCCCC1C |
| InChI | InChI=1S/C8H13NO/c1-6-4-3-5-9-8(6)7(2)10/h6H,3-5H2,1-2H3 |
| InChIKey | JVZLPEDBXLQRIU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone?
The IUPAC name of 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone (CID 566018) is 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone.
What is the SMILES notation for 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone?
The canonical SMILES for 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone is CC(=O)C1=NCCCC1C.
What is the InChIKey of 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone?
The InChIKey is JVZLPEDBXLQRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-6-4-3-5-9-8(6)7(2)10/h6H,3-5H2,1-2H3.
What are the key properties of 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone?
1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone has a molecular weight of 139.20 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethanone is sourced from PubChem (CID 566018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).