C24H33NOS — CID 56601869
(1S,3aR,4S,6S)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-9-(2-methylsulfanylethyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole (PubChem CID 56601869) has the molecular formula C24H33NOS and a molecular weight of 383.60 g/mol. Its IUPAC name is (1S,3aR,4S,6S)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-9-(2-methylsulfanylethyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole.
| Compound Name | (1S,3aR,4S,6S)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-9-(2-methylsulfanylethyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 56601869 |
| Molecular Formula | C24H33NOS |
| Molecular Weight | 383.60 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (1S,3aR,4S,6S)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-9-(2-methylsulfanylethyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
| SMILES | CSCCc1nc2c(C)c3c4c(c2o1)[C@@H](C)CC[C@@H]4[C@@H](C)C[C@H]3C=C(C)C |
| InChI | InChI=1S/C24H33NOS/c1-13(2)11-17-12-15(4)18-8-7-14(3)20-22(18)21(17)16(5)23-24(20)26-19(25-23)9-10-27-6/h11,14-15,17-18H,7-10,12H2,1-6H3/t14-,15-,17+,18+/m0/s1 |
| InChIKey | AHDIOVOPFAITIE-CWLKWCNXSA-N |
| XLogP | 7.11 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|