C23H24F2N6O3 — CID 56601938
6-(6-amino-2-fluoro-3-pyridinyl)-N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 56601938) has the molecular formula C23H24F2N6O3 and a molecular weight of 470.48 g/mol. Its IUPAC name is 6-(6-amino-2-fluoro-3-pyridinyl)-N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(6-amino-2-fluoro-3-pyridinyl)-N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56601938 |
| Molecular Formula | C23H24F2N6O3 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-(6-amino-2-fluoro-3-pyridinyl)-N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3ccc(N)nc3F)n2)C[C@@H](N)[C@]1(C)O |
| InChI | InChI=1S/C23H24F2N6O3/c1-11-23(2,33)18(26)9-17(34-11)12-7-8-28-10-16(12)30-22(32)15-5-4-14(24)20(29-15)13-3-6-19(27)31-21(13)25/h3-8,10-11,17-18,33H,9,26H2,1-2H3,(H2,27,31)(H,30,32)/t11-,17-,18-,23-/m1/s1 |
| InChIKey | RFUYYPFHTSHOHV-MGZSMOLESA-N |
| XLogP | 2.58 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|