C27H30FNO — CID 56602075
(1S,3aR,4S,6S)-9-(4-fluorophenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole (PubChem CID 56602075) has the molecular formula C27H30FNO and a molecular weight of 403.54 g/mol. Its IUPAC name is (1S,3aR,4S,6S)-9-(4-fluorophenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole.
| Compound Name | (1S,3aR,4S,6S)-9-(4-fluorophenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 56602075 |
| Molecular Formula | C27H30FNO |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (1S,3aR,4S,6S)-9-(4-fluorophenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
| SMILES | CC(C)=C[C@@H]1C[C@H](C)[C@H]2CC[C@H](C)c3c2c1c(C)c1nc(-c2ccc(F)cc2)oc31 |
| InChI | InChI=1S/C27H30FNO/c1-14(2)12-19-13-16(4)21-11-6-15(3)22-24(21)23(19)17(5)25-26(22)30-27(29-25)18-7-9-20(28)10-8-18/h7-10,12,15-16,19,21H,6,11,13H2,1-5H3/t15-,16-,19+,21+/m0/s1 |
| InChIKey | MZMXWTCPKIXGRP-ZOGSBNJCSA-N |
| XLogP | 8.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|