C22H28FN5O5S — CID 56602148
N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridine-2-carboxamide (PubChem CID 56602148) has the molecular formula C22H28FN5O5S and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56602148 |
| Molecular Formula | C22H28FN5O5S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[4-[(2R,4R,5S,6R)-4-amino-5-hydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(N3CCS(=O)(=O)CC3)n2)C[C@@H](N)[C@]1(C)O |
| InChI | InChI=1S/C22H28FN5O5S/c1-13-22(2,30)19(24)11-18(33-13)14-5-6-25-12-17(14)27-21(29)16-4-3-15(23)20(26-16)28-7-9-34(31,32)10-8-28/h3-6,12-13,18-19,30H,7-11,24H2,1-2H3,(H,27,29)/t13-,18-,19-,22-/m1/s1 |
| InChIKey | QKJAEUAXMSGGDX-ZYFHONAXSA-N |
| XLogP | 1.03 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |