C24H26N6O — CID 56602593
5-[4-(1-aminocyclobutyl)phenyl]-N-(2-methoxyethyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 56602593) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-[4-(1-aminocyclobutyl)phenyl]-N-(2-methoxyethyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 5-[4-(1-aminocyclobutyl)phenyl]-N-(2-methoxyethyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56602593 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5-[4-(1-aminocyclobutyl)phenyl]-N-(2-methoxyethyl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COCCNc1nc2nc(-c3ccc(C4(N)CCC4)cc3)c(-c3ccccc3)cn2n1 |
| InChI | InChI=1S/C24H26N6O/c1-31-15-14-26-22-28-23-27-21(18-8-10-19(11-9-18)24(25)12-5-13-24)20(16-30(23)29-22)17-6-3-2-4-7-17/h2-4,6-11,16H,5,12-15,25H2,1H3,(H,26,29) |
| InChIKey | VDKNUAWGZGHGAU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|